xsdaata with pydantic works but using the classes manually aint a good idea

src/main.py

@@ -28,59 +28,8 @@ def validate_dataclass_patterns(obj) -> None:
                     validate_dataclass_patterns(item)
 
 def main():
-    # Success - just use object() since it's defined as Optional[object]
-    success = object()
-
-    # Now we need to create the missing nested classes that aren't fully defined
-    # Let's create minimal implementations for the empty classes
-    
-    # Create basic implementations for the empty nested classes
-    class RoomType(ab.BaseModel):
-        room_type_code: str = "A"
-        room_classification_code: str = "5" 
-        room_type: str = "8"
-    
-    class GuestCount(ab.BaseModel):
-        count: int = 1
-    
-    class TimeSpanImpl(ab.BaseModel):
-        start: str
-        end: str
-    
-    class PersonName(ab.BaseModel):
-        given_name: str
-        surname: str
-    
-    class Customer(ab.BaseModel):
-        language: str = "de"
-        gender: str = "Male"  # Use valid gender
-        person_name: PersonName
-    
-    class Profile(ab.BaseModel):
-        customer: Customer
-    
-    class ProfileInfo(ab.BaseModel):
-        profile: Profile
-    
-    class Profiles(ab.BaseModel):
-        profile_info: ProfileInfo
-    
-    class ResGuest(ab.BaseModel):
-        profiles: Profiles
-    
-    class HotelReservationId(ab.BaseModel):
-        res_id_type: str
-        res_id_source_context: str
-        res_id_value: str
-        res_id_source: str
-
-    # Build the structure using the Pydantic models
-    person_name = PersonName(given_name="Otto", surname="Mustermann")
-    customer = Customer(person_name=person_name)
-    profile = Profile(customer=customer)
-    profile_info = ProfileInfo(profile=profile)
-    profiles = Profiles(profile_info=profile_info)
-    res_guest = ResGuest(profiles=profiles)
+    # Success - use None instead of object() for cleaner XML output
+    success = None
 
     # UniqueID
     unique_id = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.UniqueId(
@@ -88,28 +37,70 @@ def main():
         id="6b34fe24ac2ff811"
     )
 
+    # TimeSpan - use the actual nested class
+    time_span = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.RoomStays.RoomStay.TimeSpan()
+
+    # RoomStay with TimeSpan
+    room_stay = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.RoomStays.RoomStay(
+        time_span=time_span
+    )
+    room_stays = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.RoomStays(
+        room_stay=[room_stay]
+    )
+
+    profile = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest.Profiles.ProfileInfo.Profile(
+        customer=ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest.Profiles.ProfileInfo.Profile.Customer(
+            person_name=ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest.Profiles.ProfileInfo.Profile.Customer.PersonName(
+                given_name="John",
+                surname="Doe"
+            )
+        )
+    )
+
+    # Use the actual nested Profiles class
+
+
+    profile_info = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest.Profiles.ProfileInfo(
+        profile=profile)
+
+    profiles = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest.Profiles(profile_info=profile_info)
+
+    # ResGuest
+    res_guest = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest(
+        profiles=profiles
+    )
+    res_guests = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests(
+        res_guest=res_guest
+    )
+
+    # Use the actual nested HotelReservationIds class
+    hotel_res_ids = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGlobalInfo.HotelReservationIds(
+        hotel_reservation_id=[]
+    )
+
     # Basic property info
     basic_property_info = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGlobalInfo.BasicPropertyInfo(
         hotel_code="123", 
         hotel_name="Frangart Inn"
     )
 
-    # Build a minimal reservation structure
+    # ResGlobalInfo
+    res_global_info = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGlobalInfo(
+        hotel_reservation_ids=hotel_res_ids,
+        basic_property_info=basic_property_info
+    )
+
+    # Hotel Reservation
     hotel_reservation = ab.OtaResRetrieveRs.ReservationsList.HotelReservation(
         create_date_time=datetime.now(timezone.utc).isoformat(),
         res_status=ab.HotelReservationResStatus.REQUESTED,
         room_stay_reservation="true",
-        unique_id=unique_id
+        unique_id=unique_id,
+        room_stays=room_stays,
+        res_guests=res_guests,
+        res_global_info=res_global_info
     )
 
-    # Add the basic property info to res_global_info
-    res_global_info = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGlobalInfo(
-        basic_property_info=basic_property_info
-    )
-    
-    # Update the hotel reservation with all required fields
-    hotel_reservation.res_global_info = res_global_info
-
     reservations_list = ab.OtaResRetrieveRs.ReservationsList(hotel_reservation=[hotel_reservation])
 
     # Root element
@@ -135,7 +126,10 @@ def main():
         )
         
         serializer = XmlSerializer(config=config)
-        xml_string = serializer.render(ota_res_retrieve_rs)
+        
+        # Use ns_map to control namespace prefixes - set default namespace
+        ns_map = {None: "http://www.opentravel.org/OTA/2003/05"}
+        xml_string = serializer.render(ota_res_retrieve_rs, ns_map=ns_map)
         
         with open('output.xml', 'w', encoding='utf-8') as outfile:
             outfile.write(xml_string)
@@ -156,12 +150,11 @@ def main():
             
         parsed_result = parser.from_string(xml_content, ab.OtaResRetrieveRs)
         print("✅ Round-trip validation successful!")
-        print(f"Parsed reservation status: {parsed_result.res_status}")
+        print(f"Parsed reservation status: {parsed_result.reservations_list.hotel_reservation[0].res_status}")
         
     except Exception as e:
         print(f"❌ Validation/Serialization failed: {e}")
 
 
-
 if __name__ == "__main__":
     main()

src/output.xml

@@ -1,12 +1,33 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<ns0:OTA_ResRetrieveRS xmlns:ns0="http://www.opentravel.org/OTA/2003/05" Version="7.000">
-  <ns0:Success>&lt;object object at 0x7fd2fa5a0f40&gt;</ns0:Success>
-  <ns0:ReservationsList>
-    <ns0:HotelReservation CreateDateTime="2025-09-24T08:56:11.806672+00:00" ResStatus="Requested" RoomStayReservation="true">
-      <ns0:UniqueID Type="14" ID="6b34fe24ac2ff811"/>
-      <ns0:ResGlobalInfo>
-        <ns0:BasicPropertyInfo HotelCode="123" HotelName="Frangart Inn"/>
-      </ns0:ResGlobalInfo>
-    </ns0:HotelReservation>
-  </ns0:ReservationsList>
-</ns0:OTA_ResRetrieveRS>
+<OTA_ResRetrieveRS xmlns="http://www.opentravel.org/OTA/2003/05" Version="7.000">
+  <ReservationsList>
+    <HotelReservation CreateDateTime="2025-09-24T09:16:59.563720+00:00" ResStatus="Requested" RoomStayReservation="true">
+      <UniqueID Type="14" ID="6b34fe24ac2ff811"/>
+      <RoomStays>
+        <RoomStay>
+          <TimeSpan/>
+        </RoomStay>
+      </RoomStays>
+      <ResGuests>
+        <ResGuest>
+          <Profiles>
+            <ProfileInfo>
+              <Profile>
+                <Customer>
+                  <PersonName>
+                    <GivenName>John</GivenName>
+                    <Surname>Doe</Surname>
+                  </PersonName>
+                </Customer>
+              </Profile>
+            </ProfileInfo>
+          </Profiles>
+        </ResGuest>
+      </ResGuests>
+      <ResGlobalInfo>
+        <HotelReservationIDs/>
+        <BasicPropertyInfo HotelCode="123" HotelName="Frangart Inn"/>
+      </ResGlobalInfo>
+    </HotelReservation>
+  </ReservationsList>
+</OTA_ResRetrieveRS>