From a9116b0e0c158f807c8066a224bb39ef56838df5 Mon Sep 17 00:00:00 2001 From: Jonas Linter Date: Wed, 24 Sep 2025 11:18:57 +0200 Subject: [PATCH] xsdaata with pydantic works but using the classes manually aint a good idea --- src/main.py | 125 +++++++++++++++++++++++-------------------------- src/output.xml | 43 ++++++++++++----- 2 files changed, 91 insertions(+), 77 deletions(-) diff --git a/src/main.py b/src/main.py index 3470ecf..42eef3b 100644 --- a/src/main.py +++ b/src/main.py @@ -28,59 +28,8 @@ def validate_dataclass_patterns(obj) -> None: validate_dataclass_patterns(item) def main(): - # Success - just use object() since it's defined as Optional[object] - success = object() - - # Now we need to create the missing nested classes that aren't fully defined - # Let's create minimal implementations for the empty classes - - # Create basic implementations for the empty nested classes - class RoomType(ab.BaseModel): - room_type_code: str = "A" - room_classification_code: str = "5" - room_type: str = "8" - - class GuestCount(ab.BaseModel): - count: int = 1 - - class TimeSpanImpl(ab.BaseModel): - start: str - end: str - - class PersonName(ab.BaseModel): - given_name: str - surname: str - - class Customer(ab.BaseModel): - language: str = "de" - gender: str = "Male" # Use valid gender - person_name: PersonName - - class Profile(ab.BaseModel): - customer: Customer - - class ProfileInfo(ab.BaseModel): - profile: Profile - - class Profiles(ab.BaseModel): - profile_info: ProfileInfo - - class ResGuest(ab.BaseModel): - profiles: Profiles - - class HotelReservationId(ab.BaseModel): - res_id_type: str - res_id_source_context: str - res_id_value: str - res_id_source: str - - # Build the structure using the Pydantic models - person_name = PersonName(given_name="Otto", surname="Mustermann") - customer = Customer(person_name=person_name) - profile = Profile(customer=customer) - profile_info = ProfileInfo(profile=profile) - profiles = Profiles(profile_info=profile_info) - res_guest = ResGuest(profiles=profiles) + # Success - use None instead of object() for cleaner XML output + success = None # UniqueID unique_id = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.UniqueId( @@ -88,28 +37,70 @@ def main(): id="6b34fe24ac2ff811" ) + # TimeSpan - use the actual nested class + time_span = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.RoomStays.RoomStay.TimeSpan() + + # RoomStay with TimeSpan + room_stay = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.RoomStays.RoomStay( + time_span=time_span + ) + room_stays = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.RoomStays( + room_stay=[room_stay] + ) + + profile = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest.Profiles.ProfileInfo.Profile( + customer=ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest.Profiles.ProfileInfo.Profile.Customer( + person_name=ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest.Profiles.ProfileInfo.Profile.Customer.PersonName( + given_name="John", + surname="Doe" + ) + ) + ) + + # Use the actual nested Profiles class + + + profile_info = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest.Profiles.ProfileInfo( + profile=profile) + + profiles = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest.Profiles(profile_info=profile_info) + + # ResGuest + res_guest = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests.ResGuest( + profiles=profiles + ) + res_guests = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGuests( + res_guest=res_guest + ) + + # Use the actual nested HotelReservationIds class + hotel_res_ids = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGlobalInfo.HotelReservationIds( + hotel_reservation_id=[] + ) + # Basic property info basic_property_info = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGlobalInfo.BasicPropertyInfo( hotel_code="123", hotel_name="Frangart Inn" ) - # Build a minimal reservation structure + # ResGlobalInfo + res_global_info = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGlobalInfo( + hotel_reservation_ids=hotel_res_ids, + basic_property_info=basic_property_info + ) + + # Hotel Reservation hotel_reservation = ab.OtaResRetrieveRs.ReservationsList.HotelReservation( create_date_time=datetime.now(timezone.utc).isoformat(), res_status=ab.HotelReservationResStatus.REQUESTED, room_stay_reservation="true", - unique_id=unique_id + unique_id=unique_id, + room_stays=room_stays, + res_guests=res_guests, + res_global_info=res_global_info ) - # Add the basic property info to res_global_info - res_global_info = ab.OtaResRetrieveRs.ReservationsList.HotelReservation.ResGlobalInfo( - basic_property_info=basic_property_info - ) - - # Update the hotel reservation with all required fields - hotel_reservation.res_global_info = res_global_info - reservations_list = ab.OtaResRetrieveRs.ReservationsList(hotel_reservation=[hotel_reservation]) # Root element @@ -135,7 +126,10 @@ def main(): ) serializer = XmlSerializer(config=config) - xml_string = serializer.render(ota_res_retrieve_rs) + + # Use ns_map to control namespace prefixes - set default namespace + ns_map = {None: "http://www.opentravel.org/OTA/2003/05"} + xml_string = serializer.render(ota_res_retrieve_rs, ns_map=ns_map) with open('output.xml', 'w', encoding='utf-8') as outfile: outfile.write(xml_string) @@ -156,12 +150,11 @@ def main(): parsed_result = parser.from_string(xml_content, ab.OtaResRetrieveRs) print("✅ Round-trip validation successful!") - print(f"Parsed reservation status: {parsed_result.res_status}") + print(f"Parsed reservation status: {parsed_result.reservations_list.hotel_reservation[0].res_status}") except Exception as e: print(f"❌ Validation/Serialization failed: {e}") - if __name__ == "__main__": main() \ No newline at end of file diff --git a/src/output.xml b/src/output.xml index a8c0571..8b22f0d 100644 --- a/src/output.xml +++ b/src/output.xml @@ -1,12 +1,33 @@ - - <object object at 0x7fd2fa5a0f40> - - - - - - - - - + + + + + + + + + + + + + + + + + John + Doe + + + + + + + + + + + + + +